| Name | 2-Phenylpyrrolidine |
| Synonyms | AKOS BB-8859 2-Phenylpyrrolidine 2-PHENYLPYRROLIDINE Pyrrolidine,2-Phenyl- 2-PHENYLPYRROLIDINE HCL (RS)-2-phenylpyrrolidine (2S)-2-phenylpyrrolidinium (2R)-2-phenylpyrrolidinium 2-phenylpyrrolidine hydrochloride |
| CAS | 1006-64-0 |
| InChI | InChI=1/C10H13N.ClH/c1-2-5-9(6-3-1)10-7-4-8-11-10;/h1-3,5-6,10-11H,4,7-8H2;1H |
| Molecular Formula | C10H13N |
| Molar Mass | 147.22 |
| Density | 0.988±0.06 g/cm3(Predicted) |
| Melting Point | 42-43 °C |
| Boling Point | 68°C |
| Flash Point | 120°C |
| Vapor Presure | 0.00409mmHg at 25°C |
| Appearance | Colorless liquid |
| pKa | 10.13±0.10(Predicted) |
| Storage Condition | 2-8°C(protect from light) |
| MDL | MFCD01631835 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R52 - Harmful to aquatic organisms R36 - Irritating to the eyes R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| Hazard Note | Harmful |
| Hazard Class | IRRITANT |